About 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one
5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one (PubChem CID 105441146) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one.
Molecular Properties
| Compound Name | 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one |
| PubChem CID | 105441146 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one |
| SMILES | CC(C)(C)N1C(=O)OCC12CNC2 |
| InChI | InChI=1S/C9H16N2O2/c1-8(2,3)11-7(12)13-6-9(11)4-10-5-9/h10H,4-6H2,1-3H3 |
| InChIKey | ANTPMFJWMZTVLV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one?
The IUPAC name of 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one (CID 105441146) is 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one.
What is the SMILES notation for 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one?
The canonical SMILES for 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one is CC(C)(C)N1C(=O)OCC12CNC2.
What is the InChIKey of 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one?
The InChIKey is ANTPMFJWMZTVLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-8(2,3)11-7(12)13-6-9(11)4-10-5-9/h10H,4-6H2,1-3H3.
What are the key properties of 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one?
5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one has a molecular weight of 184.24 g/mol, XLogP of 0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-7-oxa-2,5-diazaspiro[3.4]octan-6-one is sourced from PubChem (CID 105441146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).