About 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine
5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine (PubChem CID 105441953) has the molecular formula C8H8ClNS
and a molecular weight of 185.68 g/mol. Its IUPAC name is 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine.
Molecular Properties
| Compound Name | 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine |
| PubChem CID | 105441953 |
| Molecular Formula | C8H8ClNS |
| Molecular Weight | 185.68 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine |
| SMILES | Clc1nccc2c1CCSC2 |
| InChI | InChI=1S/C8H8ClNS/c9-8-7-2-4-11-5-6(7)1-3-10-8/h1,3H,2,4-5H2 |
| InChIKey | SDKTUMXMAUVGLY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.68 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine?
The IUPAC name of 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine (CID 105441953) is 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine.
What is the SMILES notation for 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine?
The canonical SMILES for 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine is Clc1nccc2c1CCSC2.
What is the InChIKey of 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine?
The InChIKey is SDKTUMXMAUVGLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNS/c9-8-7-2-4-11-5-6(7)1-3-10-8/h1,3H,2,4-5H2.
What are the key properties of 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine?
5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine has a molecular weight of 185.68 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3,4-dihydro-1H-thiopyrano[4,3-c]pyridine is sourced from PubChem (CID 105441953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).