About methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate
methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 105442031) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| PubChem CID | 105442031 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)C1COC(CCCN)=N1 |
| InChI | InChI=1S/C8H14N2O3/c1-12-8(11)6-5-13-7(10-6)3-2-4-9/h6H,2-5,9H2,1H3 |
| InChIKey | ZPHAWYKETYYRMZ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (CID 105442031) is methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate is COC(=O)C1COC(CCCN)=N1.
What is the InChIKey of methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is ZPHAWYKETYYRMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-12-8(11)6-5-13-7(10-6)3-2-4-9/h6H,2-5,9H2,1H3.
What are the key properties of methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate?
methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 186.21 g/mol, XLogP of -0.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-aminopropyl)-4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 105442031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).