C17H17ClF3N — CID 10544224
(2S)-N,N-dibenzyl-3-chloro-1,1,1-trifluoropropan-2-amine (PubChem CID 10544224) has the molecular formula C17H17ClF3N and a molecular weight of 327.78 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-3-chloro-1,1,1-trifluoropropan-2-amine.
| Compound Name | (2S)-N,N-dibenzyl-3-chloro-1,1,1-trifluoropropan-2-amine |
|---|---|
| PubChem CID | 10544224 |
| Molecular Formula | C17H17ClF3N |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (2S)-N,N-dibenzyl-3-chloro-1,1,1-trifluoropropan-2-amine |
| SMILES | FC(F)(F)[C@@H](CCl)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C17H17ClF3N/c18-11-16(17(19,20)21)22(12-14-7-3-1-4-8-14)13-15-9-5-2-6-10-15/h1-10,16H,11-13H2/t16-/m1/s1 |
| InChIKey | WJYLWXYOROSFRM-MRXNPFEDSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|