C12H14N2 — CID 105442245
7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-amine (PubChem CID 105442245) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-amine.
| Compound Name | 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-amine |
|---|---|
| PubChem CID | 105442245 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-1-amine |
| SMILES | Cc1ccc2cc3n(c2c1)C(N)CC3 |
| InChI | InChI=1S/C12H14N2/c1-8-2-3-9-7-10-4-5-12(13)14(10)11(9)6-8/h2-3,6-7,12H,4-5,13H2,1H3 |
| InChIKey | XDGBGOCCLJPBTF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |