C12H14N2 — CID 105442254
9-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole (PubChem CID 105442254) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 9-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole.
| Compound Name | 9-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 105442254 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 9-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1cccc2[nH]c3c(c12)CNCC3 |
| InChI | InChI=1S/C12H14N2/c1-8-3-2-4-11-12(8)9-7-13-6-5-10(9)14-11/h2-4,13-14H,5-7H2,1H3 |
| InChIKey | SKOVNLSMYXFUSV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |