C20H24O4 — CID 10544262
(2R,3aS,9aR)-2-(2-hydroxypropan-2-yl)-9a-(3-methylbut-2-enyl)-3,3a-dihydro-2H-benzo[f][1]benzofuran-4,9-dione (PubChem CID 10544262) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (2R,3aS,9aR)-2-(2-hydroxypropan-2-yl)-9a-(3-methylbut-2-enyl)-3,3a-dihydro-2H-benzo[f][1]benzofuran-4,9-dione.
| Compound Name | (2R,3aS,9aR)-2-(2-hydroxypropan-2-yl)-9a-(3-methylbut-2-enyl)-3,3a-dihydro-2H-benzo[f][1]benzofuran-4,9-dione |
|---|---|
| PubChem CID | 10544262 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (2R,3aS,9aR)-2-(2-hydroxypropan-2-yl)-9a-(3-methylbut-2-enyl)-3,3a-dihydro-2H-benzo[f][1]benzofuran-4,9-dione |
| SMILES | CC(C)=CC[C@@]12O[C@@H](C(C)(C)O)C[C@@H]1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H24O4/c1-12(2)9-10-20-15(11-16(24-20)19(3,4)23)17(21)13-7-5-6-8-14(13)18(20)22/h5-9,15-16,23H,10-11H2,1-4H3/t15-,16-,20-/m1/s1 |
| InChIKey | MRHRLPQBVGIOOL-JXXFODFXSA-N |
| XLogP | 3.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|