C8H10F2N2O — CID 105442968
(4,4-difluoro-1,5,6,7-tetrahydroindazol-3-yl)methanol (PubChem CID 105442968) has the molecular formula C8H10F2N2O and a molecular weight of 188.18 g/mol. Its IUPAC name is (4,4-difluoro-1,5,6,7-tetrahydroindazol-3-yl)methanol.
| Compound Name | (4,4-difluoro-1,5,6,7-tetrahydroindazol-3-yl)methanol |
|---|---|
| PubChem CID | 105442968 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (4,4-difluoro-1,5,6,7-tetrahydroindazol-3-yl)methanol |
| SMILES | OCc1n[nH]c2c1C(F)(F)CCC2 |
| InChI | InChI=1S/C8H10F2N2O/c9-8(10)3-1-2-5-7(8)6(4-13)12-11-5/h13H,1-4H2,(H,11,12) |
| InChIKey | BRAADPJDTROWLO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |