About 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde
6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde (PubChem CID 105444107) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde |
| PubChem CID | 105444107 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde |
| SMILES | CC(C)c1cnc2c(C=O)nnn2c1 |
| InChI | InChI=1S/C9H10N4O/c1-6(2)7-3-10-9-8(5-14)11-12-13(9)4-7/h3-6H,1-2H3 |
| InChIKey | LZMUJVJOJFVVAT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde?
The IUPAC name of 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde (CID 105444107) is 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde.
What is the SMILES notation for 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde?
The canonical SMILES for 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde is CC(C)c1cnc2c(C=O)nnn2c1.
What is the InChIKey of 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde?
The InChIKey is LZMUJVJOJFVVAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c1-6(2)7-3-10-9-8(5-14)11-12-13(9)4-7/h3-6H,1-2H3.
What are the key properties of 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde?
6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde has a molecular weight of 190.21 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yltriazolo[1,5-a]pyrimidine-3-carbaldehyde is sourced from PubChem (CID 105444107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).