About N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine
N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine (PubChem CID 105444370) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine.
Molecular Properties
| Compound Name | N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine |
| PubChem CID | 105444370 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine |
| SMILES | CNCCc1onc2ccc(C)cc12 |
| InChI | InChI=1S/C11H14N2O/c1-8-3-4-10-9(7-8)11(14-13-10)5-6-12-2/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | NEERUHQMDKXSQO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine?
The IUPAC name of N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine (CID 105444370) is N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine.
What is the SMILES notation for N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine?
The canonical SMILES for N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine is CNCCc1onc2ccc(C)cc12.
What is the InChIKey of N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine?
The InChIKey is NEERUHQMDKXSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-8-3-4-10-9(7-8)11(14-13-10)5-6-12-2/h3-4,7,12H,5-6H2,1-2H3.
What are the key properties of N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine?
N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine has a molecular weight of 190.25 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(5-methyl-2,1-benzoxazol-3-yl)ethanamine is sourced from PubChem (CID 105444370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).