C17H34O4Si — CID 10544442
[(E,3R)-3-[(2R,4S,6R)-4-(2,2-dimethoxyethyl)-6-methoxyoxan-2-yl]but-1-enyl]-trimethylsilane (PubChem CID 10544442) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is [(E,3R)-3-[(2R,4S,6R)-4-(2,2-dimethoxyethyl)-6-methoxyoxan-2-yl]but-1-enyl]-trimethylsilane.
| Compound Name | [(E,3R)-3-[(2R,4S,6R)-4-(2,2-dimethoxyethyl)-6-methoxyoxan-2-yl]but-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 10544442 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | [(E,3R)-3-[(2R,4S,6R)-4-(2,2-dimethoxyethyl)-6-methoxyoxan-2-yl]but-1-enyl]-trimethylsilane |
| SMILES | COC(C[C@H]1C[C@H](OC)O[C@@H]([C@H](C)/C=C/[Si](C)(C)C)C1)OC |
| InChI | InChI=1S/C17H34O4Si/c1-13(8-9-22(5,6)7)15-10-14(11-16(18-2)19-3)12-17(20-4)21-15/h8-9,13-17H,10-12H2,1-7H3/b9-8+/t13-,14+,15-,17-/m1/s1 |
| InChIKey | CSUXBSXGLOOTCV-CRJCRGCFSA-N |
| XLogP | 3.83 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|