About 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine
1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine (PubChem CID 105444608) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine |
| PubChem CID | 105444608 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine |
| SMILES | Cc1ccc(CCC2(N)CC2)nc1C |
| InChI | InChI=1S/C12H18N2/c1-9-3-4-11(14-10(9)2)5-6-12(13)7-8-12/h3-4H,5-8,13H2,1-2H3 |
| InChIKey | FENKWLLIQOEWFS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine?
The IUPAC name of 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine (CID 105444608) is 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine.
What is the SMILES notation for 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine?
The canonical SMILES for 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine is Cc1ccc(CCC2(N)CC2)nc1C.
What is the InChIKey of 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine?
The InChIKey is FENKWLLIQOEWFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-9-3-4-11(14-10(9)2)5-6-12(13)7-8-12/h3-4H,5-8,13H2,1-2H3.
What are the key properties of 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine?
1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine has a molecular weight of 190.29 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(5,6-dimethyl-2-pyridinyl)ethyl]cyclopropan-1-amine is sourced from PubChem (CID 105444608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).