About 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone
1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone (PubChem CID 105446019) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone |
| PubChem CID | 105446019 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone |
| SMILES | CC(=O)c1cc2c(nc1N)COCC2 |
| InChI | InChI=1S/C10H12N2O2/c1-6(13)8-4-7-2-3-14-5-9(7)12-10(8)11/h4H,2-3,5H2,1H3,(H2,11,12) |
| InChIKey | UKQMQKIBSUWEJI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone?
The IUPAC name of 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone (CID 105446019) is 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone.
What is the SMILES notation for 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone?
The canonical SMILES for 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone is CC(=O)c1cc2c(nc1N)COCC2.
What is the InChIKey of 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone?
The InChIKey is UKQMQKIBSUWEJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-6(13)8-4-7-2-3-14-5-9(7)12-10(8)11/h4H,2-3,5H2,1H3,(H2,11,12).
What are the key properties of 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone?
1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone has a molecular weight of 192.22 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-6,8-dihydro-5H-pyrano[3,4-b]pyridin-3-yl)ethanone is sourced from PubChem (CID 105446019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).