C19H27NO4 — CID 10544638
methyl (6S)-6-(hydroxymethyl)-4-oxo-5-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3-carboxylate (PubChem CID 10544638) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is methyl (6S)-6-(hydroxymethyl)-4-oxo-5-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3-carboxylate.
| Compound Name | methyl (6S)-6-(hydroxymethyl)-4-oxo-5-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3-carboxylate |
|---|---|
| PubChem CID | 10544638 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | methyl (6S)-6-(hydroxymethyl)-4-oxo-5-azabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3-carboxylate |
| SMILES | COC(=O)C1Cc2ccccc2CCCCCC[C@@H](CO)NC1=O |
| InChI | InChI=1S/C19H27NO4/c1-24-19(23)17-12-15-10-7-6-9-14(15)8-4-2-3-5-11-16(13-21)20-18(17)22/h6-7,9-10,16-17,21H,2-5,8,11-13H2,1H3,(H,20,22)/t16-,17?/m0/s1 |
| InChIKey | OLDIPQNMLHHQLO-BHWOMJMDSA-N |
| XLogP | 2.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|