About 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol
2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol (PubChem CID 105447110) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol |
| PubChem CID | 105447110 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol |
| SMILES | NCC1(O)CCc2ccc(O)cc2C1 |
| InChI | InChI=1S/C11H15NO2/c12-7-11(14)4-3-8-1-2-10(13)5-9(8)6-11/h1-2,5,13-14H,3-4,6-7,12H2 |
| InChIKey | WXLPZDZIVBXEII-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol?
The IUPAC name of 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol (CID 105447110) is 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol.
What is the SMILES notation for 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol?
The canonical SMILES for 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol is NCC1(O)CCc2ccc(O)cc2C1.
What is the InChIKey of 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol?
The InChIKey is WXLPZDZIVBXEII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c12-7-11(14)4-3-8-1-2-10(13)5-9(8)6-11/h1-2,5,13-14H,3-4,6-7,12H2.
What are the key properties of 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol?
2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol has a molecular weight of 193.25 g/mol, XLogP of 0.57, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3,4-dihydro-1H-naphthalene-2,7-diol is sourced from PubChem (CID 105447110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).