C9H11FN4 — CID 105447953
3-(5-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)propan-1-amine (PubChem CID 105447953) has the molecular formula C9H11FN4 and a molecular weight of 194.21 g/mol. Its IUPAC name is 3-(5-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)propan-1-amine.
| Compound Name | 3-(5-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 105447953 |
| Molecular Formula | C9H11FN4 |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 3-(5-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)propan-1-amine |
| SMILES | NCCCc1nnc2cccc(F)n12 |
| InChI | InChI=1S/C9H11FN4/c10-7-3-1-4-8-12-13-9(14(7)8)5-2-6-11/h1,3-4H,2,5-6,11H2 |
| InChIKey | AGSVUCOEDRABPN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|