C9H14N4O — CID 105448142
[5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine (PubChem CID 105448142) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine.
| Compound Name | [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine |
|---|---|
| PubChem CID | 105448142 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine |
| SMILES | NCc1nncc(C2CCOCC2)n1 |
| InChI | InChI=1S/C9H14N4O/c10-5-9-12-8(6-11-13-9)7-1-3-14-4-2-7/h6-7H,1-5,10H2 |
| InChIKey | VSVCGHXLUKUALI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |