About [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine
[5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine (PubChem CID 105448142) has the molecular formula C9H14N4O
and a molecular weight of 194.24 g/mol. Its IUPAC name is [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine.
Molecular Properties
| Compound Name | [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine |
| PubChem CID | 105448142 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine |
| SMILES | NCc1nncc(C2CCOCC2)n1 |
| InChI | InChI=1S/C9H14N4O/c10-5-9-12-8(6-11-13-9)7-1-3-14-4-2-7/h6-7H,1-5,10H2 |
| InChIKey | VSVCGHXLUKUALI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine?
The IUPAC name of [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine (CID 105448142) is [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine.
What is the SMILES notation for [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine?
The canonical SMILES for [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine is NCc1nncc(C2CCOCC2)n1.
What is the InChIKey of [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine?
The InChIKey is VSVCGHXLUKUALI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O/c10-5-9-12-8(6-11-13-9)7-1-3-14-4-2-7/h6-7H,1-5,10H2.
What are the key properties of [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine?
[5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine has a molecular weight of 194.24 g/mol, XLogP of 0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(oxan-4-yl)-1,2,4-triazin-3-yl]methanamine is sourced from PubChem (CID 105448142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).