C11H18N2O — CID 105448467
3-amino-1-ethyl-6-(2-methylpropyl)pyridin-2-one (PubChem CID 105448467) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-amino-1-ethyl-6-(2-methylpropyl)pyridin-2-one.
| Compound Name | 3-amino-1-ethyl-6-(2-methylpropyl)pyridin-2-one |
|---|---|
| PubChem CID | 105448467 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3-amino-1-ethyl-6-(2-methylpropyl)pyridin-2-one |
| SMILES | CCn1c(CC(C)C)ccc(N)c1=O |
| InChI | InChI=1S/C11H18N2O/c1-4-13-9(7-8(2)3)5-6-10(12)11(13)14/h5-6,8H,4,7,12H2,1-3H3 |
| InChIKey | COQGUPOIKPQKBT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |