C21H24N2O2 — CID 10544855
2-[[(2,4-dimethylphenyl)methylamino]methyl]-3,4,7,9-tetrahydro-2H-pyrano[2,3-e]indol-8-one (PubChem CID 10544855) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[[(2,4-dimethylphenyl)methylamino]methyl]-3,4,7,9-tetrahydro-2H-pyrano[2,3-e]indol-8-one.
| Compound Name | 2-[[(2,4-dimethylphenyl)methylamino]methyl]-3,4,7,9-tetrahydro-2H-pyrano[2,3-e]indol-8-one |
|---|---|
| PubChem CID | 10544855 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-[[(2,4-dimethylphenyl)methylamino]methyl]-3,4,7,9-tetrahydro-2H-pyrano[2,3-e]indol-8-one |
| SMILES | Cc1ccc(CNCC2CCc3ccc4c(c3O2)CC(=O)N4)c(C)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-13-3-4-16(14(2)9-13)11-22-12-17-7-5-15-6-8-19-18(21(15)25-17)10-20(24)23-19/h3-4,6,8-9,17,22H,5,7,10-12H2,1-2H3,(H,23,24) |
| InChIKey | HCIJVCFSUACOOT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |