C11H17NO2 — CID 105449196
1-(2-amino-3-methoxyphenyl)butan-1-ol (PubChem CID 105449196) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 1-(2-amino-3-methoxyphenyl)butan-1-ol.
| Compound Name | 1-(2-amino-3-methoxyphenyl)butan-1-ol |
|---|---|
| PubChem CID | 105449196 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 1-(2-amino-3-methoxyphenyl)butan-1-ol |
| SMILES | CCCC(O)c1cccc(OC)c1N |
| InChI | InChI=1S/C11H17NO2/c1-3-5-9(13)8-6-4-7-10(14-2)11(8)12/h4,6-7,9,13H,3,5,12H2,1-2H3 |
| InChIKey | AKLWFSMGFQDLOL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|