About 3-(3,3-difluorothian-4-yl)propan-1-amine
3-(3,3-difluorothian-4-yl)propan-1-amine (PubChem CID 105449347) has the molecular formula C8H15F2NS
and a molecular weight of 195.28 g/mol. Its IUPAC name is 3-(3,3-difluorothian-4-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(3,3-difluorothian-4-yl)propan-1-amine |
| PubChem CID | 105449347 |
| Molecular Formula | C8H15F2NS |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 3-(3,3-difluorothian-4-yl)propan-1-amine |
| SMILES | NCCCC1CCSCC1(F)F |
| InChI | InChI=1S/C8H15F2NS/c9-8(10)6-12-5-3-7(8)2-1-4-11/h7H,1-6,11H2 |
| InChIKey | UOYBJLGGLYPRHU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,3-difluorothian-4-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-difluorothian-4-yl)propan-1-amine?
The IUPAC name of 3-(3,3-difluorothian-4-yl)propan-1-amine (CID 105449347) is 3-(3,3-difluorothian-4-yl)propan-1-amine.
What is the SMILES notation for 3-(3,3-difluorothian-4-yl)propan-1-amine?
The canonical SMILES for 3-(3,3-difluorothian-4-yl)propan-1-amine is NCCCC1CCSCC1(F)F.
What is the InChIKey of 3-(3,3-difluorothian-4-yl)propan-1-amine?
The InChIKey is UOYBJLGGLYPRHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NS/c9-8(10)6-12-5-3-7(8)2-1-4-11/h7H,1-6,11H2.
What are the key properties of 3-(3,3-difluorothian-4-yl)propan-1-amine?
3-(3,3-difluorothian-4-yl)propan-1-amine has a molecular weight of 195.28 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluorothian-4-yl)propan-1-amine is sourced from PubChem (CID 105449347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).