C10H16N2S — CID 105450241
[1-(4-ethyl-1,3-thiazol-2-yl)cyclobutyl]methanamine (PubChem CID 105450241) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is [1-(4-ethyl-1,3-thiazol-2-yl)cyclobutyl]methanamine.
| Compound Name | [1-(4-ethyl-1,3-thiazol-2-yl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 105450241 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | [1-(4-ethyl-1,3-thiazol-2-yl)cyclobutyl]methanamine |
| SMILES | CCc1csc(C2(CN)CCC2)n1 |
| InChI | InChI=1S/C10H16N2S/c1-2-8-6-13-9(12-8)10(7-11)4-3-5-10/h6H,2-5,7,11H2,1H3 |
| InChIKey | BHRIPNASFFOJQX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |