About 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol
2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol (PubChem CID 105450329) has the molecular formula C9H9ClN2O
and a molecular weight of 196.64 g/mol. Its IUPAC name is 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol |
| PubChem CID | 105450329 |
| Molecular Formula | C9H9ClN2O |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol |
| SMILES | OCCc1ncc2cccc(Cl)n12 |
| InChI | InChI=1S/C9H9ClN2O/c10-8-3-1-2-7-6-11-9(4-5-13)12(7)8/h1-3,6,13H,4-5H2 |
| InChIKey | QBHYVTKOZDQVFT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol?
The IUPAC name of 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol (CID 105450329) is 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol.
What is the SMILES notation for 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol?
The canonical SMILES for 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol is OCCc1ncc2cccc(Cl)n12.
What is the InChIKey of 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol?
The InChIKey is QBHYVTKOZDQVFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN2O/c10-8-3-1-2-7-6-11-9(4-5-13)12(7)8/h1-3,6,13H,4-5H2.
What are the key properties of 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol?
2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol has a molecular weight of 196.64 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloroimidazo[1,5-a]pyridin-3-yl)ethanol is sourced from PubChem (CID 105450329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).