About 5-(thian-4-yl)-2H-1,2,4-triazin-3-one
5-(thian-4-yl)-2H-1,2,4-triazin-3-one (PubChem CID 105450795) has the molecular formula C8H11N3OS
and a molecular weight of 197.26 g/mol. Its IUPAC name is 5-(thian-4-yl)-2H-1,2,4-triazin-3-one.
Molecular Properties
| Compound Name | 5-(thian-4-yl)-2H-1,2,4-triazin-3-one |
| PubChem CID | 105450795 |
| Molecular Formula | C8H11N3OS |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 5-(thian-4-yl)-2H-1,2,4-triazin-3-one |
| SMILES | O=c1nc(C2CCSCC2)cn[nH]1 |
| InChI | InChI=1S/C8H11N3OS/c12-8-10-7(5-9-11-8)6-1-3-13-4-2-6/h5-6H,1-4H2,(H,10,11,12) |
| InChIKey | DEONSJLRJHKYTO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(thian-4-yl)-2H-1,2,4-triazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(thian-4-yl)-2H-1,2,4-triazin-3-one?
The IUPAC name of 5-(thian-4-yl)-2H-1,2,4-triazin-3-one (CID 105450795) is 5-(thian-4-yl)-2H-1,2,4-triazin-3-one.
What is the SMILES notation for 5-(thian-4-yl)-2H-1,2,4-triazin-3-one?
The canonical SMILES for 5-(thian-4-yl)-2H-1,2,4-triazin-3-one is O=c1nc(C2CCSCC2)cn[nH]1.
What is the InChIKey of 5-(thian-4-yl)-2H-1,2,4-triazin-3-one?
The InChIKey is DEONSJLRJHKYTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3OS/c12-8-10-7(5-9-11-8)6-1-3-13-4-2-6/h5-6H,1-4H2,(H,10,11,12).
What are the key properties of 5-(thian-4-yl)-2H-1,2,4-triazin-3-one?
5-(thian-4-yl)-2H-1,2,4-triazin-3-one has a molecular weight of 197.26 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(thian-4-yl)-2H-1,2,4-triazin-3-one is sourced from PubChem (CID 105450795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).