C8H14F3N2+ — CID 10545081
[(Z)-3-(dimethylamino)-2-(trifluoromethyl)prop-2-enylidene]-dimethylazanium (PubChem CID 10545081) has the molecular formula C8H14F3N2+ and a molecular weight of 195.21 g/mol. Its IUPAC name is [(Z)-3-(dimethylamino)-2-(trifluoromethyl)prop-2-enylidene]-dimethylazanium.
| Compound Name | [(Z)-3-(dimethylamino)-2-(trifluoromethyl)prop-2-enylidene]-dimethylazanium |
|---|---|
| PubChem CID | 10545081 |
| Molecular Formula | C8H14F3N2+ |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | [(Z)-3-(dimethylamino)-2-(trifluoromethyl)prop-2-enylidene]-dimethylazanium |
| SMILES | CN(C)/C=C(/C=[N+](C)C)C(F)(F)F |
| InChI | InChI=1S/C8H14F3N2/c1-12(2)5-7(6-13(3)4)8(9,10)11/h5-6H,1-4H3/q+1 |
| InChIKey | MUKQAPOSFYDZBX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|