About 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol
5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol (PubChem CID 105451209) has the molecular formula C10H12ClNO
and a molecular weight of 197.67 g/mol. Its IUPAC name is 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol.
Molecular Properties
| Compound Name | 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol |
| PubChem CID | 105451209 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.67 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol |
| SMILES | CC1(O)CNc2cccc(Cl)c2C1 |
| InChI | InChI=1S/C10H12ClNO/c1-10(13)5-7-8(11)3-2-4-9(7)12-6-10/h2-4,12-13H,5-6H2,1H3 |
| InChIKey | NRTITSPHYZQHJC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.67 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol?
The IUPAC name of 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol (CID 105451209) is 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol.
What is the SMILES notation for 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol?
The canonical SMILES for 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol is CC1(O)CNc2cccc(Cl)c2C1.
What is the InChIKey of 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol?
The InChIKey is NRTITSPHYZQHJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO/c1-10(13)5-7-8(11)3-2-4-9(7)12-6-10/h2-4,12-13H,5-6H2,1H3.
What are the key properties of 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol?
5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol has a molecular weight of 197.67 g/mol, XLogP of 2.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-methyl-2,4-dihydro-1H-quinolin-3-ol is sourced from PubChem (CID 105451209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).