C9H11ClN2O — CID 105451850
4-chloro-2-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-3-one (PubChem CID 105451850) has the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. Its IUPAC name is 4-chloro-2-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-3-one.
| Compound Name | 4-chloro-2-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-3-one |
|---|---|
| PubChem CID | 105451850 |
| Molecular Formula | C9H11ClN2O |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 4-chloro-2-methyl-5,6,7,8-tetrahydro-2,7-naphthyridin-3-one |
| SMILES | Cn1cc2c(c(Cl)c1=O)CCNC2 |
| InChI | InChI=1S/C9H11ClN2O/c1-12-5-6-4-11-3-2-7(6)8(10)9(12)13/h5,11H,2-4H2,1H3 |
| InChIKey | ACZYEOPTMQXVRZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|