About 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine
2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine (PubChem CID 105452022) has the molecular formula C6H11F2NO2S
and a molecular weight of 199.22 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine |
| PubChem CID | 105452022 |
| Molecular Formula | C6H11F2NO2S |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine |
| SMILES | NCC(F)(F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H11F2NO2S/c7-6(8,4-9)5-1-2-12(10,11)3-5/h5H,1-4,9H2 |
| InChIKey | CDMDAVIMAVSFCO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine (CID 105452022) is 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine is NCC(F)(F)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine?
The InChIKey is CDMDAVIMAVSFCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2NO2S/c7-6(8,4-9)5-1-2-12(10,11)3-5/h5H,1-4,9H2.
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine?
2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine has a molecular weight of 199.22 g/mol, XLogP of 0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanamine is sourced from PubChem (CID 105452022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).