About 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol
2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol (PubChem CID 105452679) has the molecular formula C6H10F2O3S
and a molecular weight of 200.21 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol.
Molecular Properties
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol |
| PubChem CID | 105452679 |
| Molecular Formula | C6H10F2O3S |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol |
| SMILES | O=S1(=O)CCC(C(F)(F)CO)C1 |
| InChI | InChI=1S/C6H10F2O3S/c7-6(8,4-9)5-1-2-12(10,11)3-5/h5,9H,1-4H2 |
| InChIKey | NOTPCAOKJJZEFE-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol (CID 105452679) is 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol is O=S1(=O)CCC(C(F)(F)CO)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol?
The InChIKey is NOTPCAOKJJZEFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10F2O3S/c7-6(8,4-9)5-1-2-12(10,11)3-5/h5,9H,1-4H2.
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol?
2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol has a molecular weight of 200.21 g/mol, XLogP of 0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethanol is sourced from PubChem (CID 105452679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).