About 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide
3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide (PubChem CID 105453528) has the molecular formula C7H11N3O2S
and a molecular weight of 201.25 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide |
| PubChem CID | 105453528 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCNC(c2cnc[nH]2)C1 |
| InChI | InChI=1S/C7H11N3O2S/c11-13(12)2-1-9-7(4-13)6-3-8-5-10-6/h3,5,7,9H,1-2,4H2,(H,8,10) |
| InChIKey | RWHBPNSFUCHVSC-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide?
The IUPAC name of 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide (CID 105453528) is 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide.
What is the SMILES notation for 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide?
The canonical SMILES for 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide is O=S1(=O)CCNC(c2cnc[nH]2)C1.
What is the InChIKey of 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide?
The InChIKey is RWHBPNSFUCHVSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2S/c11-13(12)2-1-9-7(4-13)6-3-8-5-10-6/h3,5,7,9H,1-2,4H2,(H,8,10).
What are the key properties of 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide?
3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide has a molecular weight of 201.25 g/mol, XLogP of -0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-imidazol-5-yl)-1,4-thiazinane 1,1-dioxide is sourced from PubChem (CID 105453528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).