C14H19N — CID 105453860
2-(7-methyl-2,3-dihydro-1H-inden-1-yl)pyrrolidine (PubChem CID 105453860) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-(7-methyl-2,3-dihydro-1H-inden-1-yl)pyrrolidine.
| Compound Name | 2-(7-methyl-2,3-dihydro-1H-inden-1-yl)pyrrolidine |
|---|---|
| PubChem CID | 105453860 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-(7-methyl-2,3-dihydro-1H-inden-1-yl)pyrrolidine |
| SMILES | Cc1cccc2c1C(C1CCCN1)CC2 |
| InChI | InChI=1S/C14H19N/c1-10-4-2-5-11-7-8-12(14(10)11)13-6-3-9-15-13/h2,4-5,12-13,15H,3,6-9H2,1H3 |
| InChIKey | MZMSFFMSZKPQIR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |