About 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine
3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 105454085) has the molecular formula C7H5F3N4
and a molecular weight of 202.14 g/mol. Its IUPAC name is 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine |
| PubChem CID | 105454085 |
| Molecular Formula | C7H5F3N4 |
| Molecular Weight | 202.14 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | Nc1ccn2ncc(C(F)(F)F)c2n1 |
| InChI | InChI=1S/C7H5F3N4/c8-7(9,10)4-3-12-14-2-1-5(11)13-6(4)14/h1-3H,(H2,11,13) |
| InChIKey | BVNRKZQRHHCVMX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine?
The IUPAC name of 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine (CID 105454085) is 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine.
What is the SMILES notation for 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine?
The canonical SMILES for 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine is Nc1ccn2ncc(C(F)(F)F)c2n1.
What is the InChIKey of 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine?
The InChIKey is BVNRKZQRHHCVMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3N4/c8-7(9,10)4-3-12-14-2-1-5(11)13-6(4)14/h1-3H,(H2,11,13).
What are the key properties of 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine?
3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine has a molecular weight of 202.14 g/mol, XLogP of 1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)pyrazolo[1,5-a]pyrimidin-5-amine is sourced from PubChem (CID 105454085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).