About 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine
1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine (PubChem CID 105454611) has the molecular formula C11H14N4
and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine |
| PubChem CID | 105454611 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine |
| SMILES | NC1(CCc2cc3nccnc3[nH]2)CC1 |
| InChI | InChI=1S/C11H14N4/c12-11(3-4-11)2-1-8-7-9-10(15-8)14-6-5-13-9/h5-7H,1-4,12H2,(H,14,15) |
| InChIKey | MWDJIXUFUADTAH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine?
The IUPAC name of 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine (CID 105454611) is 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine.
What is the SMILES notation for 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine?
The canonical SMILES for 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine is NC1(CCc2cc3nccnc3[nH]2)CC1.
What is the InChIKey of 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine?
The InChIKey is MWDJIXUFUADTAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4/c12-11(3-4-11)2-1-8-7-9-10(15-8)14-6-5-13-9/h5-7H,1-4,12H2,(H,14,15).
What are the key properties of 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine?
1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine has a molecular weight of 202.26 g/mol, XLogP of 1.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(5H-pyrrolo[2,3-b]pyrazin-6-yl)ethyl]cyclopropan-1-amine is sourced from PubChem (CID 105454611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).