C13H17NO — CID 105455598
5-(2-aminopropan-2-yl)-7,8-dihydronaphthalen-1-ol (PubChem CID 105455598) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 5-(2-aminopropan-2-yl)-7,8-dihydronaphthalen-1-ol.
| Compound Name | 5-(2-aminopropan-2-yl)-7,8-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 105455598 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 5-(2-aminopropan-2-yl)-7,8-dihydronaphthalen-1-ol |
| SMILES | CC(C)(N)C1=CCCc2c(O)cccc21 |
| InChI | InChI=1S/C13H17NO/c1-13(2,14)11-7-3-6-10-9(11)5-4-8-12(10)15/h4-5,7-8,15H,3,6,14H2,1-2H3 |
| InChIKey | CYXQMTXYNCEBGE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |