About 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol
6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol (PubChem CID 105455603) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol.
Molecular Properties
| Compound Name | 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol |
| PubChem CID | 105455603 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol |
| SMILES | CNC(C)C1=Cc2ccc(O)cc2CC1 |
| InChI | InChI=1S/C13H17NO/c1-9(14-2)10-3-4-12-8-13(15)6-5-11(12)7-10/h5-9,14-15H,3-4H2,1-2H3 |
| InChIKey | AFHLFDXSHPJDNP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol?
The IUPAC name of 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol (CID 105455603) is 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol.
What is the SMILES notation for 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol?
The canonical SMILES for 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol is CNC(C)C1=Cc2ccc(O)cc2CC1.
What is the InChIKey of 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol?
The InChIKey is AFHLFDXSHPJDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-9(14-2)10-3-4-12-8-13(15)6-5-11(12)7-10/h5-9,14-15H,3-4H2,1-2H3.
What are the key properties of 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol?
6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol has a molecular weight of 203.28 g/mol, XLogP of 2.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(methylamino)ethyl]-7,8-dihydronaphthalen-2-ol is sourced from PubChem (CID 105455603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).