About 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol
8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol (PubChem CID 105455610) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol.
Molecular Properties
| Compound Name | 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol |
| PubChem CID | 105455610 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol |
| SMILES | CC(C)(N)C1=CCCc2ccc(O)cc21 |
| InChI | InChI=1S/C13H17NO/c1-13(2,14)12-5-3-4-9-6-7-10(15)8-11(9)12/h5-8,15H,3-4,14H2,1-2H3 |
| InChIKey | WOYXKTRZONYFPC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol?
The IUPAC name of 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol (CID 105455610) is 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol.
What is the SMILES notation for 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol?
The canonical SMILES for 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol is CC(C)(N)C1=CCCc2ccc(O)cc21.
What is the InChIKey of 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol?
The InChIKey is WOYXKTRZONYFPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-13(2,14)12-5-3-4-9-6-7-10(15)8-11(9)12/h5-8,15H,3-4,14H2,1-2H3.
What are the key properties of 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol?
8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol has a molecular weight of 203.28 g/mol, XLogP of 2.46, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-aminopropan-2-yl)-5,6-dihydronaphthalen-2-ol is sourced from PubChem (CID 105455610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).