About 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol
2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 105455650) has the molecular formula C13H17NO
and a molecular weight of 203.29 g/mol. Its IUPAC name is 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 105455650 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | Oc1ccc2c(c1)CC(NC1CCC1)C2 |
| InChI | InChI=1S/C13H17NO/c15-13-5-4-9-6-12(7-10(9)8-13)14-11-2-1-3-11/h4-5,8,11-12,14-15H,1-3,6-7H2 |
| InChIKey | YSKFJLAHEWJBIV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol (CID 105455650) is 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol is Oc1ccc2c(c1)CC(NC1CCC1)C2.
What is the InChIKey of 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol?
The InChIKey is YSKFJLAHEWJBIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c15-13-5-4-9-6-12(7-10(9)8-13)14-11-2-1-3-11/h4-5,8,11-12,14-15H,1-3,6-7H2.
What are the key properties of 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol?
2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol has a molecular weight of 203.29 g/mol, XLogP of 2.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclobutylamino)-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 105455650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).