C9H14F2N2O — CID 105455972
3a-(difluoromethyl)-1-methyl-3,4,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one (PubChem CID 105455972) has the molecular formula C9H14F2N2O and a molecular weight of 204.22 g/mol. Its IUPAC name is 3a-(difluoromethyl)-1-methyl-3,4,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one.
| Compound Name | 3a-(difluoromethyl)-1-methyl-3,4,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 105455972 |
| Molecular Formula | C9H14F2N2O |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 3a-(difluoromethyl)-1-methyl-3,4,5,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one |
| SMILES | CN1C(=O)CC2(C(F)F)CNCCC12 |
| InChI | InChI=1S/C9H14F2N2O/c1-13-6-2-3-12-5-9(6,8(10)11)4-7(13)14/h6,8,12H,2-5H2,1H3 |
| InChIKey | CTADMKBFIVPCDH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |