C19H25NO5 — CID 10545609
(2S,3S,4S)-4-[1-(4-butoxyphenyl)ethenyl]-3-(carboxymethyl)pyrrolidine-2-carboxylic acid (PubChem CID 10545609) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is (2S,3S,4S)-4-[1-(4-butoxyphenyl)ethenyl]-3-(carboxymethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S)-4-[1-(4-butoxyphenyl)ethenyl]-3-(carboxymethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10545609 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2S,3S,4S)-4-[1-(4-butoxyphenyl)ethenyl]-3-(carboxymethyl)pyrrolidine-2-carboxylic acid |
| SMILES | C=C(c1ccc(OCCCC)cc1)[C@H]1CN[C@H](C(=O)O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C19H25NO5/c1-3-4-9-25-14-7-5-13(6-8-14)12(2)16-11-20-18(19(23)24)15(16)10-17(21)22/h5-8,15-16,18,20H,2-4,9-11H2,1H3,(H,21,22)(H,23,24)/t15-,16+,18-/m0/s1 |
| InChIKey | KXBXJQAOMRSKAY-JZXOWHBKSA-N |
| XLogP | 2.64 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|