C12H16N2O — CID 105456575
4-(azetidin-1-yl)-1,2,3,4-tetrahydroquinolin-8-ol (PubChem CID 105456575) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-(azetidin-1-yl)-1,2,3,4-tetrahydroquinolin-8-ol.
| Compound Name | 4-(azetidin-1-yl)-1,2,3,4-tetrahydroquinolin-8-ol |
|---|---|
| PubChem CID | 105456575 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 4-(azetidin-1-yl)-1,2,3,4-tetrahydroquinolin-8-ol |
| SMILES | Oc1cccc2c1NCCC2N1CCC1 |
| InChI | InChI=1S/C12H16N2O/c15-11-4-1-3-9-10(14-7-2-8-14)5-6-13-12(9)11/h1,3-4,10,13,15H,2,5-8H2 |
| InChIKey | AAQVTZZPMWPMKY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|