C8H6ClFO3 — CID 105456921
2-(2-chloro-4,5-dihydroxyphenyl)-2-fluoroacetaldehyde (PubChem CID 105456921) has the molecular formula C8H6ClFO3 and a molecular weight of 204.58 g/mol. Its IUPAC name is 2-(2-chloro-4,5-dihydroxyphenyl)-2-fluoroacetaldehyde.
| Compound Name | 2-(2-chloro-4,5-dihydroxyphenyl)-2-fluoroacetaldehyde |
|---|---|
| PubChem CID | 105456921 |
| Molecular Formula | C8H6ClFO3 |
| Molecular Weight | 204.58 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | 2-(2-chloro-4,5-dihydroxyphenyl)-2-fluoroacetaldehyde |
| SMILES | O=CC(F)c1cc(O)c(O)cc1Cl |
| InChI | InChI=1S/C8H6ClFO3/c9-5-2-8(13)7(12)1-4(5)6(10)3-11/h1-3,6,12-13H |
| InChIKey | ZEGXHLIZKCMRLX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.58 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|