2-cyclopropyl-2,2-difluoroethanesulfonyl chloride

C5H7ClF2O2S — CID 105456937

IUPAC2-cyclopropyl-2,2-difluoroethanesulfonyl chloride
SMILESO=S(=O)(Cl)CC(F)(F)C1CC1
InChIInChI=1S/C5H7ClF2O2S/c6-11(9,10)3-5(7,8)4-1-2-4/h4H,1-3H2
InChIKeyQUAVNVZTKSUJJH-UHFFFAOYSA-N
MW204.62 g/mol
LogP1.60
Rot. Bonds3

About 2-cyclopropyl-2,2-difluoroethanesulfonyl chloride

2-cyclopropyl-2,2-difluoroethanesulfonyl chloride (PubChem CID 105456937) has the molecular formula C5H7ClF2O2S and a molecular weight of 204.62 g/mol. Its IUPAC name is 2-cyclopropyl-2,2-difluoroethanesulfonyl chloride.

Molecular Properties

Compound Name2-cyclopropyl-2,2-difluoroethanesulfonyl chloride
PubChem CID105456937
Molecular FormulaC5H7ClF2O2S
Molecular Weight204.62 g/mol
Exact Mass203.98
IUPAC Name2-cyclopropyl-2,2-difluoroethanesulfonyl chloride
SMILESO=S(=O)(Cl)CC(F)(F)C1CC1
InChIInChI=1S/C5H7ClF2O2S/c6-11(9,10)3-5(7,8)4-1-2-4/h4H,1-3H2
InChIKeyQUAVNVZTKSUJJH-UHFFFAOYSA-N
XLogP1.60
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.62
LogP ≤ 51.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2-cyclopropyl-2,2-difluoroethanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclopropyl-2,2-difluoroethanesulfonyl chloride?
The IUPAC name of 2-cyclopropyl-2,2-difluoroethanesulfonyl chloride (CID 105456937) is 2-cyclopropyl-2,2-difluoroethanesulfonyl chloride.
What is the SMILES notation for 2-cyclopropyl-2,2-difluoroethanesulfonyl chloride?
The canonical SMILES for 2-cyclopropyl-2,2-difluoroethanesulfonyl chloride is O=S(=O)(Cl)CC(F)(F)C1CC1.
What is the InChIKey of 2-cyclopropyl-2,2-difluoroethanesulfonyl chloride?
The InChIKey is QUAVNVZTKSUJJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClF2O2S/c6-11(9,10)3-5(7,8)4-1-2-4/h4H,1-3H2.
What are the key properties of 2-cyclopropyl-2,2-difluoroethanesulfonyl chloride?
2-cyclopropyl-2,2-difluoroethanesulfonyl chloride has a molecular weight of 204.62 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2,2-difluoroethanesulfonyl chloride is sourced from PubChem (CID 105456937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).