C11H11NO3 — CID 105457104
4-(2-methoxyphenyl)-5-methyl-3H-1,3-oxazol-2-one (PubChem CID 105457104) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-5-methyl-3H-1,3-oxazol-2-one.
| Compound Name | 4-(2-methoxyphenyl)-5-methyl-3H-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 105457104 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 4-(2-methoxyphenyl)-5-methyl-3H-1,3-oxazol-2-one |
| SMILES | COc1ccccc1-c1[nH]c(=O)oc1C |
| InChI | InChI=1S/C11H11NO3/c1-7-10(12-11(13)15-7)8-5-3-4-6-9(8)14-2/h3-6H,1-2H3,(H,12,13) |
| InChIKey | NIIBVGIKNJTXEQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |