About [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine
[1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine (PubChem CID 105457229) has the molecular formula C11H12FN3
and a molecular weight of 205.24 g/mol. Its IUPAC name is [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine.
Molecular Properties
| Compound Name | [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine |
| PubChem CID | 105457229 |
| Molecular Formula | C11H12FN3 |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine |
| SMILES | NCC1(c2ncc3c(F)cccn23)CC1 |
| InChI | InChI=1S/C11H12FN3/c12-8-2-1-5-15-9(8)6-14-10(15)11(7-13)3-4-11/h1-2,5-6H,3-4,7,13H2 |
| InChIKey | DMOVWWLOHCMXSA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine?
The IUPAC name of [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine (CID 105457229) is [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine.
What is the SMILES notation for [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine?
The canonical SMILES for [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine is NCC1(c2ncc3c(F)cccn23)CC1.
What is the InChIKey of [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine?
The InChIKey is DMOVWWLOHCMXSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FN3/c12-8-2-1-5-15-9(8)6-14-10(15)11(7-13)3-4-11/h1-2,5-6H,3-4,7,13H2.
What are the key properties of [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine?
[1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine has a molecular weight of 205.24 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(8-fluoroimidazo[1,5-a]pyridin-3-yl)cyclopropyl]methanamine is sourced from PubChem (CID 105457229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).