C11H15N3O — CID 105457715
6-(2-aminoethyl)-1,2-dimethylindazol-3-one (PubChem CID 105457715) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-(2-aminoethyl)-1,2-dimethylindazol-3-one.
| Compound Name | 6-(2-aminoethyl)-1,2-dimethylindazol-3-one |
|---|---|
| PubChem CID | 105457715 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 6-(2-aminoethyl)-1,2-dimethylindazol-3-one |
| SMILES | Cn1c(=O)c2ccc(CCN)cc2n1C |
| InChI | InChI=1S/C11H15N3O/c1-13-10-7-8(5-6-12)3-4-9(10)11(15)14(13)2/h3-4,7H,5-6,12H2,1-2H3 |
| InChIKey | BVPQFJHLASYANK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |