C12H15NS — CID 105458271
[3-(3,6-dihydro-2H-thiopyran-4-yl)phenyl]methanamine (PubChem CID 105458271) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is [3-(3,6-dihydro-2H-thiopyran-4-yl)phenyl]methanamine.
| Compound Name | [3-(3,6-dihydro-2H-thiopyran-4-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 105458271 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | [3-(3,6-dihydro-2H-thiopyran-4-yl)phenyl]methanamine |
| SMILES | NCc1cccc(C2=CCSCC2)c1 |
| InChI | InChI=1S/C12H15NS/c13-9-10-2-1-3-12(8-10)11-4-6-14-7-5-11/h1-4,8H,5-7,9,13H2 |
| InChIKey | APZLQQGYLRQSMA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |