C15H20F3NO5 — CID 10545860
benzyl-[(1S,2R,3R,4R,5R)-2,3,4-trihydroxy-5-methylcyclopentyl]azanium;2,2,2-trifluoroacetate (PubChem CID 10545860) has the molecular formula C15H20F3NO5 and a molecular weight of 351.32 g/mol. Its IUPAC name is benzyl-[(1S,2R,3R,4R,5R)-2,3,4-trihydroxy-5-methylcyclopentyl]azanium;2,2,2-trifluoroacetate.
| Compound Name | benzyl-[(1S,2R,3R,4R,5R)-2,3,4-trihydroxy-5-methylcyclopentyl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10545860 |
| Molecular Formula | C15H20F3NO5 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | benzyl-[(1S,2R,3R,4R,5R)-2,3,4-trihydroxy-5-methylcyclopentyl]azanium;2,2,2-trifluoroacetate |
| SMILES | C[C@H]1[C@@H](O)[C@@H](O)[C@H](O)[C@H]1[NH2+]Cc1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C13H19NO3.C2HF3O2/c1-8-10(12(16)13(17)11(8)15)14-7-9-5-3-2-4-6-9;3-2(4,5)1(6)7/h2-6,8,10-17H,7H2,1H3;(H,6,7)/t8-,10+,11-,12-,13-;/m1./s1 |
| InChIKey | YKECYXPKTNEXRZ-HHOBECGFSA-N |
| XLogP | -1.85 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |