About 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal
2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal (PubChem CID 105458981) has the molecular formula C13H15FO
and a molecular weight of 206.26 g/mol. Its IUPAC name is 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal.
Molecular Properties
| Compound Name | 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal |
| PubChem CID | 105458981 |
| Molecular Formula | C13H15FO |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal |
| SMILES | CC(C)(C=O)C1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C13H15FO/c1-13(2,8-15)12-6-4-9-3-5-10(14)7-11(9)12/h3,5,7-8,12H,4,6H2,1-2H3 |
| InChIKey | BNUTZEFRSSXXIH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal?
The IUPAC name of 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal (CID 105458981) is 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal.
What is the SMILES notation for 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal?
The canonical SMILES for 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal is CC(C)(C=O)C1CCc2ccc(F)cc21.
What is the InChIKey of 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal?
The InChIKey is BNUTZEFRSSXXIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FO/c1-13(2,8-15)12-6-4-9-3-5-10(14)7-11(9)12/h3,5,7-8,12H,4,6H2,1-2H3.
What are the key properties of 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal?
2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal has a molecular weight of 206.26 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-2,3-dihydro-1H-inden-1-yl)-2-methylpropanal is sourced from PubChem (CID 105458981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).