About 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde
2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde (PubChem CID 105458999) has the molecular formula C8H14O4S
and a molecular weight of 206.26 g/mol. Its IUPAC name is 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde |
| PubChem CID | 105458999 |
| Molecular Formula | C8H14O4S |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde |
| SMILES | COC1(CC=O)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14O4S/c1-12-8(4-5-9)3-2-6-13(10,11)7-8/h5H,2-4,6-7H2,1H3 |
| InChIKey | YGJFIKYJQMEMKT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde?
The IUPAC name of 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde (CID 105458999) is 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde.
What is the SMILES notation for 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde?
The canonical SMILES for 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde is COC1(CC=O)CCCS(=O)(=O)C1.
What is the InChIKey of 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde?
The InChIKey is YGJFIKYJQMEMKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4S/c1-12-8(4-5-9)3-2-6-13(10,11)7-8/h5H,2-4,6-7H2,1H3.
What are the key properties of 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde?
2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde has a molecular weight of 206.26 g/mol, XLogP of 0.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxy-1,1-dioxothian-3-yl)acetaldehyde is sourced from PubChem (CID 105458999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).