C20H32O5 — CID 10545947
[(2S)-1-acetyloxy-3-hydroxypropan-2-yl] (E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enoate (PubChem CID 10545947) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is [(2S)-1-acetyloxy-3-hydroxypropan-2-yl] (E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enoate.
| Compound Name | [(2S)-1-acetyloxy-3-hydroxypropan-2-yl] (E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enoate |
|---|---|
| PubChem CID | 10545947 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | [(2S)-1-acetyloxy-3-hydroxypropan-2-yl] (E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-2-enoate |
| SMILES | CC(=O)OC[C@H](CO)OC(=O)/C=C(\C)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C20H32O5/c1-14(8-9-18-15(2)7-6-10-20(18,4)5)11-19(23)25-17(12-21)13-24-16(3)22/h11,17,21H,6-10,12-13H2,1-5H3/b14-11+/t17-/m0/s1 |
| InChIKey | FRCBJSJRQTTWIF-WKOYGUFESA-N |
| XLogP | 3.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|